| MolName | 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C21H20N7O3F |
| Smiles | Fc(cc1)ccc1Nc1nc(N2CCOCC2)nc(N/N=C\c(cc2)cc3c2OCO3)n1 |
| InChI | InChI=1S/C21H20FN7O3/c22-15-2-4-16(5-3-15)24-19-25-20(27-21(26-19)29-7-9-30-10-8-29)28-23-12-14-1-6-17-18(11-14)32-13-31-17/h1-6,11-12H,7-10,13H2,(H2,24,25,26,27,28) |
| InChIK | IAYMMXPRFDXMRH-UHFFFAOYSA-N |
| TotalMolweight | 437.434 |
| Molweight | 437.434 |
| MonoisotopicMass | 437.161166 |
| CLogP | 5.6741 |
| CLogS | -6.041 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 325.19 |
| Relative PSA | 0.31025 |
| PolarSurfaceArea | 106.02 |
| Druglikeness | 2.0091 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine