| MolName | 2-[4-amino-3-[(4-chlorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C18H15N6O2Cl3 |
| Smiles | NN(C(Cc(cc1)ccc1Cl)=NN1CC(N/N=C\c(ccc(Cl)c2)c2Cl)=O)C1=O |
| InChI | InChI=1S/C18H15Cl3N6O2/c19-13-4-1-11(2-5-13)7-16-25-26(18(29)27(16)22)10-17(28)24-23-9-12-3-6-14(20)8-15(12)21/h1-6,8-9H,7,10,22H2,(H,24,28) |
| InChIK | IBBIKKHSZALDQF-UHFFFAOYSA-N |
| TotalMolweight | 453.716 |
| Molweight | 453.716 |
| MonoisotopicMass | 452.032205 |
| CLogP | 2.7617 |
| CLogS | -6.163 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 317.11 |
| Relative PSA | 0.26152 |
| PolarSurfaceArea | 103.39 |
| Druglikeness | 4.8361 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-amino-3-[(4-chlorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide | 2 - 2-[4-amino-3-[(4-chlorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide