| MolName | 3-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| MolecularFormula | C9H8N7O2Cl |
| Smiles | Nn1c(N/N=C\c(cc2)cc([N+]([O-])=O)c2Cl)nnc1 |
| InChI | InChI=1S/C9H8ClN7O2/c10-7-2-1-6(3-8(7)17(18)19)4-12-14-9-15-13-5-16(9)11/h1-5H,11H2,(H,14,15) |
| InChIK | IBINGLNTVZLNMZ-UHFFFAOYSA-N |
| TotalMolweight | 281.663 |
| Molweight | 281.663 |
| MonoisotopicMass | 281.0428 |
| CLogP | 2.7837 |
| CLogS | -5.95 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 203.57 |
| Relative PSA | 0.4788 |
| PolarSurfaceArea | 126.94 |
| Druglikeness | -3.186 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine | 2 - 3-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine