| MolName | N-[(Z)-[2-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide |
| MolecularFormula | C17H13N4O2ClS |
| Smiles | O=C(c1cnccc1)N/N=C\c(cccc1)c1OCc(s1)cnc1Cl |
| InChI | InChI=1S/C17H13ClN4O2S/c18-17-20-10-14(25-17)11-24-15-6-2-1-4-12(15)9-21-22-16(23)13-5-3-7-19-8-13/h1-10H,11H2,(H,22,23) |
| InChIK | IBSXNYYOUGWCON-UHFFFAOYSA-N |
| TotalMolweight | 372.835 |
| Molweight | 372.835 |
| MonoisotopicMass | 372.044773 |
| CLogP | 3.5618 |
| CLogS | -4.715 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 279.39 |
| Relative PSA | 0.31608 |
| PolarSurfaceArea | 104.71 |
| Druglikeness | 5.0947 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide | 2 - N-[(Z)-[2-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide