| MolName | N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
| MolecularFormula | C16H10N6ClF |
| Smiles | Fc1cccc(Cl)c1/C=N\Nc(c1c2cccc1)nn1c2nnc1 |
| InChI | InChI=1S/C16H10ClFN6/c17-13-6-3-7-14(18)12(13)8-19-21-15-10-4-1-2-5-11(10)16-22-20-9-24(16)23-15/h1-9H,(H,21,23) |
| InChIK | IBUCKGXNJZBCMA-UHFFFAOYSA-N |
| TotalMolweight | 340.748 |
| Molweight | 340.748 |
| MonoisotopicMass | 340.063949 |
| CLogP | 4.6059 |
| CLogS | -6.287 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 247.14 |
| Relative PSA | 0.25827 |
| PolarSurfaceArea | 67.47 |
| Druglikeness | 2.9395 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine | 2 - N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine