| MolName | [2,4-dibromo-6-[(Z)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| MolecularFormula | C22H12N2O4Br6 |
| Smiles | O=C(COc(c(Br)cc(Br)c1)c1Br)N/N=C\c(cc(cc1Br)Br)c1OC(c(cccc1)c1Br)=O |
| InChI | InChI=1S/C22H12Br6N2O4/c23-12-5-11(20(16(26)6-12)34-22(32)14-3-1-2-4-15(14)25)9-29-30-19(31)10-33-21-17(27)7-13(24)8-18(21)28/h1-9H,10H2,(H,30,31) |
| InChIK | ICSHYSXFHIOXEO-UHFFFAOYSA-N |
| TotalMolweight | 847.771 |
| Molweight | 847.771 |
| MonoisotopicMass | 841.589724 |
| CLogP | 8.5582 |
| CLogS | -9.975 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 410.04 |
| Relative PSA | 0.1684 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 2.1789 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate | 2 - [2,4-dibromo-6-[(Z)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate