| MolName | N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-(4-bromonaphthalen-1-yl)acetamide |
| MolecularFormula | C28H22N3OBr |
| Smiles | O=C(Cc(c1ccccc11)ccc1Br)N/N=C\c1cn(Cc2ccccc2)c2c1cccc2 |
| InChI | InChI=1S/C28H22BrN3O/c29-26-15-14-21(23-10-4-5-12-25(23)26)16-28(33)31-30-17-22-19-32(18-20-8-2-1-3-9-20)27-13-7-6-11-24(22)27/h1-15,17,19H,16,18H2,(H,31,33) |
| InChIK | ICSIXKSTPOKPFP-UHFFFAOYSA-N |
| TotalMolweight | 496.407 |
| Molweight | 496.407 |
| MonoisotopicMass | 495.094623 |
| CLogP | 6.649 |
| CLogS | -7.104 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 351.3 |
| Relative PSA | 0.12206 |
| PolarSurfaceArea | 46.39 |
| Druglikeness | 4.2896 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-(4-bromonaphthalen-1-yl)acetamide | 2 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-(4-bromonaphthalen-1-yl)acetamide