| MolName | 6-chloro-N-[(Z)-(3-iodophenyl)methylideneamino]pyridazin-3-amine |
| MolecularFormula | C11H8N4ClI |
| Smiles | Clc(cc1)nnc1N/N=C\c1cccc(I)c1 |
| InChI | InChI=1S/C11H8ClIN4/c12-10-4-5-11(17-15-10)16-14-7-8-2-1-3-9(13)6-8/h1-7H,(H,16,17) |
| InChIK | ICUFMRPSMHFXHS-UHFFFAOYSA-N |
| TotalMolweight | 358.566 |
| Molweight | 358.566 |
| MonoisotopicMass | 357.948221 |
| CLogP | 4.503 |
| CLogS | -3.943 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 208.46 |
| Relative PSA | 0.21544 |
| PolarSurfaceArea | 50.17 |
| Druglikeness | 2.9193 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 6-chloro-N-[(Z)-(3-iodophenyl)methylideneamino]pyridazin-3-amine | 2 - 6-chloro-N-[(Z)-(3-iodophenyl)methylideneamino]pyridazin-3-amine