| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-(anilinomethyl)triazole-4-carboxamide |
| MolecularFormula | C21H20N10O4 |
| Smiles | NC(COc1ccc(/C=N\NC(c2c(CNc3ccccc3)n(-c3nonc3N)nn2)=O)cc1)=O |
| InChI | InChI=1S/C21H20N10O4/c22-17(32)12-34-15-8-6-13(7-9-15)10-25-27-21(33)18-16(11-24-14-4-2-1-3-5-14)31(30-26-18)20-19(23)28-35-29-20/h1-10,24H,11-12H2,(H2,22,32)(H2,23,28)(H,27,33) |
| InChIK | ICWJTNXQIMKIMG-UHFFFAOYSA-N |
| TotalMolweight | 476.456 |
| Molweight | 476.456 |
| MonoisotopicMass | 476.1669 |
| CLogP | 1.4767 |
| CLogS | -2.704 |
| H Acceptors | 14 |
| H Donors | 4 |
| TotalSurfaceArea | 364.21 |
| Relative PSA | 0.45553 |
| PolarSurfaceArea | 201.46 |
| Druglikeness | 2.653 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-(anilinomethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-(anilinomethyl)triazole-4-carboxamide