| MolName | N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-[2-(morpholine-4-carbonyl)phenyl]oxamide |
| MolecularFormula | C20H18N4O4Cl2 |
| Smiles | O=C(C(N/N=C\c(ccc(Cl)c1)c1Cl)=O)Nc(cccc1)c1C(N1CCOCC1)=O |
| InChI | InChI=1S/C20H18Cl2N4O4/c21-14-6-5-13(16(22)11-14)12-23-25-19(28)18(27)24-17-4-2-1-3-15(17)20(29)26-7-9-30-10-8-26/h1-6,11-12H,7-10H2,(H,24,27)(H,25,28) |
| InChIK | IDGLQGNZWYSELP-UHFFFAOYSA-N |
| TotalMolweight | 449.293 |
| Molweight | 449.293 |
| MonoisotopicMass | 448.07051 |
| CLogP | 3.0302 |
| CLogS | -4.707 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 326.63 |
| Relative PSA | 0.26666 |
| PolarSurfaceArea | 100.1 |
| Druglikeness | 5.0313 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-[2-(morpholine-4-carbonyl)phenyl]oxamide | 2 - N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-[2-(morpholine-4-carbonyl)phenyl]oxamide