| MolName | N-[(Z)-(2-fluorophenyl)methylideneamino]-6-piperidin-1-ylpyrimidin-4-amine |
| MolecularFormula | C16H18N5F |
| Smiles | Fc1c(/C=N\Nc2ncnc(N3CCCCC3)c2)cccc1 |
| InChI | InChI=1S/C16H18FN5/c17-14-7-3-2-6-13(14)11-20-21-15-10-16(19-12-18-15)22-8-4-1-5-9-22/h2-3,6-7,10-12H,1,4-5,8-9H2,(H,18,19,21) |
| InChIK | IDHBWLJKRKEYGD-UHFFFAOYSA-N |
| TotalMolweight | 299.352 |
| Molweight | 299.352 |
| MonoisotopicMass | 299.154623 |
| CLogP | 4.9143 |
| CLogS | -4.501 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 238.71 |
| Relative PSA | 0.20301 |
| PolarSurfaceArea | 53.41 |
| Druglikeness | 1.532 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-fluorophenyl)methylideneamino]-6-piperidin-1-ylpyrimidin-4-amine | 2 - N-[(Z)-(2-fluorophenyl)methylideneamino]-6-piperidin-1-ylpyrimidin-4-amine