| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-pyridin-4-ylmethylideneamino]triazole-4-carboxamide |
| MolecularFormula | C24H26N10O2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2ccncc2)=O)c1CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N10O2/c25-22-23(31-36-30-22)34-20(16-33-12-8-18(9-13-33)14-17-4-2-1-3-5-17)21(28-32-34)24(35)29-27-15-19-6-10-26-11-7-19/h1-7,10-11,15,18H,8-9,12-14,16H2,(H2,25,30)(H,29,35) |
| InChIK | IDICOJJNBFUDRO-UHFFFAOYSA-N |
| TotalMolweight | 486.538 |
| Molweight | 486.538 |
| MonoisotopicMass | 486.22402 |
| CLogP | 3.2156 |
| CLogS | -2.422 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 379.58 |
| Relative PSA | 0.34422 |
| PolarSurfaceArea | 153.24 |
| Druglikeness | 5.4704 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 6 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-pyridin-4-ylmethylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-pyridin-4-ylmethylideneamino]triazole-4-carboxamide