| MolName | 2-[4-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
| MolecularFormula | C16H12N2O4Br |
| Smiles | [O-]C(COc1ccc(/C=N\NC(c(cccc2)c2Br)=O)cc1)=O |
| InChI | InChI=1S/C16H13BrN2O4/c17-14-4-2-1-3-13(14)16(22)19-18-9-11-5-7-12(8-6-11)23-10-15(20)21/h1-9H,10H2,(H,19,22)(H,20,21)/p-1 |
| InChIK | IDMAJPJOLBLADK-UHFFFAOYSA-M |
| TotalMolweight | 376.185 |
| Molweight | 376.185 |
| MonoisotopicMass | 374.998044 |
| CLogP | 0.9108 |
| CLogS | -4.348 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 254.66 |
| Relative PSA | 0.28795 |
| PolarSurfaceArea | 90.82 |
| Druglikeness | 2.4564 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]phenoxy]acetate | 2 - 2-[4-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]phenoxy]acetate