| MolName | 4-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]benzenesulfonic acid |
| MolecularFormula | C13H10N2O3Cl2S |
| Smiles | OS(c(cc1)ccc1N/N=C\c(ccc(Cl)c1)c1Cl)(=O)=O |
| InChI | InChI=1S/C13H10Cl2N2O3S/c14-10-2-1-9(13(15)7-10)8-16-17-11-3-5-12(6-4-11)21(18,19)20/h1-8,17H,(H,18,19,20) |
| InChIK | IDNBAERWAHMESX-UHFFFAOYSA-N |
| TotalMolweight | 345.205 |
| Molweight | 345.205 |
| MonoisotopicMass | 343.978917 |
| CLogP | 3.8236 |
| CLogS | -3.227 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 235.01 |
| Relative PSA | 0.27509 |
| PolarSurfaceArea | 87.14 |
| Druglikeness | 1.9986 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]benzenesulfonic acid | 2 - 4-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]benzenesulfonic acid