| MolName | [3-benzoyloxy-4-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C32H24N4O6S |
| Smiles | N#Cc1c(NC(C(N/N=C\c(ccc(OC(c2ccccc2)=O)c2)c2OC(c2ccccc2)=O)=O)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C32H24N4O6S/c33-18-25-24-13-7-8-14-27(24)43-30(25)35-28(37)29(38)36-34-19-22-15-16-23(41-31(39)20-9-3-1-4-10-20)17-26(22)42-32(40)21-11-5-2-6-12-21/h1-6,9-12,15-17,19H,7-8,13-14H2,(H,35,37)(H,36,38) |
| InChIK | IDSJIOWDAJMBGQ-UHFFFAOYSA-N |
| TotalMolweight | 592.631 |
| Molweight | 592.631 |
| MonoisotopicMass | 592.141656 |
| CLogP | 6.0535 |
| CLogS | -8.49 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 450.41 |
| Relative PSA | 0.31196 |
| PolarSurfaceArea | 175.19 |
| Druglikeness | -4.4796 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.48837 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [3-benzoyloxy-4-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] benzoate | 2 - [3-benzoyloxy-4-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] benzoate