| MolName | 2-N,5-N-bis[(Z)-anthracen-9-ylmethylideneamino]furan-2,5-dicarboxamide |
| MolecularFormula | C36H24N4O3 |
| Smiles | O=C(c1ccc(C(N/N=C\c2c(cccc3)c3cc3ccccc23)=O)o1)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C36H24N4O3/c41-35(39-37-21-31-27-13-5-1-9-23(27)19-24-10-2-6-14-28(24)31)33-17-18-34(43-33)36(42)40-38-22-32-29-15-7-3-11-25(29)20-26-12-4-8-16-30(26)32/h1-22H,(H,39,41)(H,40,42) |
| InChIK | IDSOFVXYASTLJL-UHFFFAOYSA-N |
| TotalMolweight | 560.612 |
| Molweight | 560.612 |
| MonoisotopicMass | 560.184841 |
| CLogP | 8.7639 |
| CLogS | -11.956 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 428.81 |
| Relative PSA | 0.20086 |
| PolarSurfaceArea | 96.06 |
| Druglikeness | 5.5968 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48837 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 7 |
| Aromatic Atoms | 33 |
| Symmetricatoms | 27 |
| StereoCon |
Click to Load Molecule:
1 - 2-N,5-N-bis[(Z)-anthracen-9-ylmethylideneamino]furan-2,5-dicarboxamide | 2 - 2-N,5-N-bis[(Z)-anthracen-9-ylmethylideneamino]furan-2,5-dicarboxamide