| MolName | (Z)-1-(3,5-dibromo-4-phenylmethoxyphenyl)-N-morpholin-4-ylmethanimine |
| MolecularFormula | C18H18N2O2Br2 |
| Smiles | Brc1cc(/C=N\N2CCOCC2)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C18H18Br2N2O2/c19-16-10-15(12-21-22-6-8-23-9-7-22)11-17(20)18(16)24-13-14-4-2-1-3-5-14/h1-5,10-12H,6-9,13H2 |
| InChIK | IDVZNRVPXCPRKW-UHFFFAOYSA-N |
| TotalMolweight | 454.161 |
| Molweight | 454.161 |
| MonoisotopicMass | 451.9735 |
| CLogP | 4.29 |
| CLogS | -4.84 |
| H Acceptors | 4 |
| TotalSurfaceArea | 280.64 |
| Relative PSA | 0.12493 |
| PolarSurfaceArea | 34.06 |
| Druglikeness | 1.0756 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 7 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(3,5-dibromo-4-phenylmethoxyphenyl)-N-morpholin-4-ylmethanimine | 2 - (Z)-1-(3,5-dibromo-4-phenylmethoxyphenyl)-N-morpholin-4-ylmethanimine