| MolName | (Z)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(2-phenylimidazo[1,2-a]pyridin-3-yl)methanimine |
| MolecularFormula | C25H24N5Cl |
| Smiles | Clc1ccc(CN(CC2)CCN2/N=C\c2c(-c3ccccc3)nc3n2cccc3)cc1 |
| InChI | InChI=1S/C25H24ClN5/c26-22-11-9-20(10-12-22)19-29-14-16-30(17-15-29)27-18-23-25(21-6-2-1-3-7-21)28-24-8-4-5-13-31(23)24/h1-13,18H,14-17,19H2 |
| InChIK | IEINEVGSOAXDJU-UHFFFAOYSA-N |
| TotalMolweight | 429.954 |
| Molweight | 429.954 |
| MonoisotopicMass | 429.172022 |
| CLogP | 4.3717 |
| CLogS | -6.475 |
| H Acceptors | 5 |
| TotalSurfaceArea | 332.87 |
| Relative PSA | 0.11275 |
| PolarSurfaceArea | 36.14 |
| Druglikeness | 7.3065 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(2-phenylimidazo[1,2-a]pyridin-3-yl)methanimine | 2 - (Z)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(2-phenylimidazo[1,2-a]pyridin-3-yl)methanimine