| MolName | 4-amino-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| MolecularFormula | C10H8N6OCl2 |
| Smiles | N/C(/c1nonc1N)=N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C10H8Cl2N6O/c11-6-2-1-5(7(12)3-6)4-15-16-9(13)8-10(14)18-19-17-8/h1-4H,(H2,13,16)(H2,14,18) |
| InChIK | IFEOYIJHSPXSGY-UHFFFAOYSA-N |
| TotalMolweight | 299.121 |
| Molweight | 299.121 |
| MonoisotopicMass | 298.013663 |
| CLogP | 3.391 |
| CLogS | -4.237 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 215.84 |
| Relative PSA | 0.41517 |
| PolarSurfaceArea | 115.68 |
| Druglikeness | 2.574 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide | 2 - 4-amino-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide