| MolName | 2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C23H18N7O2Br |
| Smiles | Brc1c(/C=N\Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)cc2OCOc2c1 |
| InChI | InChI=1S/C23H18BrN7O2/c24-18-12-20-19(32-14-33-20)11-15(18)13-25-31-23-29-21(26-16-7-3-1-4-8-16)28-22(30-23)27-17-9-5-2-6-10-17/h1-13H,14H2,(H3,26,27,28,29,30,31) |
| InChIK | IFEXWOKKENPIQB-UHFFFAOYSA-N |
| TotalMolweight | 504.347 |
| Molweight | 504.347 |
| MonoisotopicMass | 503.070534 |
| CLogP | 8.1599 |
| CLogS | -8.036 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 346.85 |
| Relative PSA | 0.28485 |
| PolarSurfaceArea | 105.58 |
| Druglikeness | 0.29843 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 11 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine | 2 - 2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine