| MolName | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine |
| MolecularFormula | C23H15N2O3F |
| Smiles | Fc(cc1)ccc1-c1nc(cc(cc2)/N=C/C=C/c(cc3)cc4c3OCO4)c2o1 |
| InChI | InChI=1S/C23H15FN2O3/c24-17-6-4-16(5-7-17)23-26-19-13-18(8-10-20(19)29-23)25-11-1-2-15-3-9-21-22(12-15)28-14-27-21/h1-13H,14H2 |
| InChIK | IFHLYRHAVRNCRR-UHFFFAOYSA-N |
| TotalMolweight | 386.381 |
| Molweight | 386.381 |
| MonoisotopicMass | 386.106671 |
| CLogP | 4.9187 |
| CLogS | -7.465 |
| H Acceptors | 5 |
| TotalSurfaceArea | 293.7 |
| Relative PSA | 0.19268 |
| PolarSurfaceArea | 56.85 |
| Druglikeness | -1.36 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-3-(1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine | 2 - (E)-3-(1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine