| MolName | 2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one |
| MolecularFormula | C21H15N4OBr |
| Smiles | O=C1N(c2ccccc2)C(N/N=C\c2cccc(Br)c2)=Nc2c1cccc2 |
| InChI | InChI=1S/C21H15BrN4O/c22-16-8-6-7-15(13-16)14-23-25-21-24-19-12-5-4-11-18(19)20(27)26(21)17-9-2-1-3-10-17/h1-14H,(H,24,25) |
| InChIK | IFVPVOKFSFRGGQ-UHFFFAOYSA-N |
| TotalMolweight | 419.281 |
| Molweight | 419.281 |
| MonoisotopicMass | 418.042922 |
| CLogP | 5.0641 |
| CLogS | -6.631 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 285.15 |
| Relative PSA | 0.1791 |
| PolarSurfaceArea | 57.06 |
| Druglikeness | 2.7273 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48148 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 2 |
| Amides | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one | 2 - 2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-3-phenylquinazolin-4-one