| MolName | 4-amino-N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C10H7N6O4Cl |
| Smiles | Nc1nonc1C(N/N=C/c(cc(cc1)[N+]([O-])=O)c1Cl)=O |
| InChI | InChI=1S/C10H7ClN6O4/c11-7-2-1-6(17(19)20)3-5(7)4-13-14-10(18)8-9(12)16-21-15-8/h1-4H,(H2,12,16)(H,14,18) |
| InChIK | IGAWAKPIKQHSDD-UHFFFAOYSA-N |
| TotalMolweight | 310.657 |
| Molweight | 310.657 |
| MonoisotopicMass | 310.021731 |
| CLogP | 1.1254 |
| CLogS | -3.785 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 221.81 |
| Relative PSA | 0.53086 |
| PolarSurfaceArea | 152.22 |
| Druglikeness | 1.1977 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide