| MolName | 4-N-(4-nitrophenyl)-2-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C26H19N9O5 |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(Nc2ccccc2)nc(N/N=C\c2ccc(-c3cccc([N+]([O-])=O)c3)o2)n1)=O |
| InChI | InChI=1S/C26H19N9O5/c36-34(37)20-11-9-19(10-12-20)29-25-30-24(28-18-6-2-1-3-7-18)31-26(32-25)33-27-16-22-13-14-23(40-22)17-5-4-8-21(15-17)35(38)39/h1-16H,(H3,28,29,30,31,32,33) |
| InChIK | IGFPHPDPYTUCMF-UHFFFAOYSA-N |
| TotalMolweight | 537.495 |
| Molweight | 537.495 |
| MonoisotopicMass | 537.150916 |
| CLogP | 5.9078 |
| CLogS | -8.871 |
| H Acceptors | 14 |
| H Donors | 3 |
| TotalSurfaceArea | 404.75 |
| Relative PSA | 0.37986 |
| PolarSurfaceArea | 191.9 |
| Druglikeness | -0.62811 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.525 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-(4-nitrophenyl)-2-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine | 2 - 4-N-(4-nitrophenyl)-2-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine