| MolName | 4-chloro-2-[5-[(Z)-1,2,4-triazol-4-yliminomethyl]furan-2-yl]benzoic acid |
| MolecularFormula | C14H9N4O3Cl |
| Smiles | OC(c(ccc(Cl)c1)c1-c1ccc(/C=N\n2cnnc2)o1)=O |
| InChI | InChI=1S/C14H9ClN4O3/c15-9-1-3-11(14(20)21)12(5-9)13-4-2-10(22-13)6-18-19-7-16-17-8-19/h1-8H,(H,20,21) |
| InChIK | IGGOXPUMOGYCOY-UHFFFAOYSA-N |
| TotalMolweight | 316.703 |
| Molweight | 316.703 |
| MonoisotopicMass | 316.036318 |
| CLogP | 2.2583 |
| CLogS | -6.519 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 233.47 |
| Relative PSA | 0.3451 |
| PolarSurfaceArea | 93.51 |
| Druglikeness | 5.8767 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-2-[5-[(Z)-1,2,4-triazol-4-yliminomethyl]furan-2-yl]benzoic acid | 2 - 4-chloro-2-[5-[(Z)-1,2,4-triazol-4-yliminomethyl]furan-2-yl]benzoic acid