| MolName | (Z)-1-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanimine |
| MolecularFormula | C19H19N5Cl2 |
| Smiles | Clc1c(/C=N\N2CCN(Cc(cc3)ccc3Cl)CC2)n(cccc2)c2n1 |
| InChI | InChI=1S/C19H19Cl2N5/c20-16-6-4-15(5-7-16)14-24-9-11-25(12-10-24)22-13-17-19(21)23-18-3-1-2-8-26(17)18/h1-8,13H,9-12,14H2 |
| InChIK | IGRQRDPSNDWGLF-UHFFFAOYSA-N |
| TotalMolweight | 388.301 |
| Molweight | 388.301 |
| MonoisotopicMass | 387.101749 |
| CLogP | 3.3249 |
| CLogS | -5.196 |
| H Acceptors | 5 |
| TotalSurfaceArea | 288.53 |
| Relative PSA | 0.13007 |
| PolarSurfaceArea | 36.14 |
| Druglikeness | 7.3264 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanimine | 2 - (Z)-1-(2-chloroimidazo[1,2-a]pyridin-3-yl)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanimine