| MolName | 2,4-dinitro-6-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]phenolate |
| MolecularFormula | C14H8N5O6 |
| Smiles | [O-]c(c(/C=N/c(cc1)cc(N2)c1NC2=O)cc([N+]([O-])=O)c1)c1[N+]([O-])=O |
| InChI | InChI=1S/C14H9N5O6/c20-13-7(3-9(18(22)23)5-12(13)19(24)25)6-15-8-1-2-10-11(4-8)17-14(21)16-10/h1-6,20H,(H2,16,17,21)/p-1 |
| InChIK | IGRVGPGVBYBJOJ-UHFFFAOYSA-M |
| TotalMolweight | 342.247 |
| Molweight | 342.247 |
| MonoisotopicMass | 342.04746 |
| CLogP | -1.8418 |
| CLogS | -4.724 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 239.82 |
| Relative PSA | 0.51118 |
| PolarSurfaceArea | 168.19 |
| Druglikeness | -4.4343 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Amides | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-dinitro-6-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]phenolate | 2 - 2,4-dinitro-6-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]phenolate