| MolName | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-morpholin-4-ylsulfonyl-4-nitroaniline |
| MolecularFormula | C17H16N4O5Cl2S |
| Smiles | [O-][N+](c(cc1)cc(S(N2CCOCC2)(=O)=O)c1N/N=C\c(c(Cl)ccc1)c1Cl)=O |
| InChI | InChI=1S/C17H16Cl2N4O5S/c18-14-2-1-3-15(19)13(14)11-20-21-16-5-4-12(23(24)25)10-17(16)29(26,27)22-6-8-28-9-7-22/h1-5,10-11,21H,6-9H2 |
| InChIK | IGYUKYDMIBUDLR-UHFFFAOYSA-N |
| TotalMolweight | 459.309 |
| Molweight | 459.309 |
| MonoisotopicMass | 458.021845 |
| CLogP | 4.1741 |
| CLogS | -4.287 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 314.17 |
| Relative PSA | 0.30404 |
| PolarSurfaceArea | 125.2 |
| Druglikeness | -2.4589 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.48276 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-morpholin-4-ylsulfonyl-4-nitroaniline | 2 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-morpholin-4-ylsulfonyl-4-nitroaniline