| MolName | 3-(4-fluorophenyl)-N-[(Z)-(4-oxochromen-3-yl)methylideneamino]-1-phenylpyrazole-4-carboxamide |
| MolecularFormula | C26H17N4O3F |
| Smiles | O=C(c1cn(-c2ccccc2)nc1-c(cc1)ccc1F)N/N=C\C1=COc(cccc2)c2C1=O |
| InChI | InChI=1S/C26H17FN4O3/c27-19-12-10-17(11-13-19)24-22(15-31(30-24)20-6-2-1-3-7-20)26(33)29-28-14-18-16-34-23-9-5-4-8-21(23)25(18)32/h1-16H,(H,29,33) |
| InChIK | IHEHFNKVTIRBEP-UHFFFAOYSA-N |
| TotalMolweight | 452.444 |
| Molweight | 452.444 |
| MonoisotopicMass | 452.128469 |
| CLogP | 3.3388 |
| CLogS | -6.098 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 339.78 |
| Relative PSA | 0.22629 |
| PolarSurfaceArea | 85.58 |
| Druglikeness | 4.9104 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | twice activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-fluorophenyl)-N-[(Z)-(4-oxochromen-3-yl)methylideneamino]-1-phenylpyrazole-4-carboxamide | 2 - 3-(4-fluorophenyl)-N-[(Z)-(4-oxochromen-3-yl)methylideneamino]-1-phenylpyrazole-4-carboxamide