| MolName | N-[(Z)-2-bicyclo[2.2.1]heptanylmethylideneamino]-2,4-dichlorobenzamide |
| MolecularFormula | C15H16N2OCl2 |
| Smiles | O=C(c(ccc(Cl)c1)c1Cl)N/N=C\C1C(CC2)CC2C1 |
| InChI | InChI=1S/C15H16Cl2N2O/c16-12-3-4-13(14(17)7-12)15(20)19-18-8-11-6-9-1-2-10(11)5-9/h3-4,7-11H,1-2,5-6H2,(H,19,20) |
| InChIK | IHWVROKCASYHCP-UHFFFAOYSA-N |
| TotalMolweight | 311.211 |
| Molweight | 311.211 |
| MonoisotopicMass | 310.063967 |
| CLogP | 3.9064 |
| CLogS | -5.407 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 223.61 |
| Relative PSA | 0.16104 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 3.8585 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| StereoCenters | 3 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 4 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - N-[(Z)-2-bicyclo[2.2.1]heptanylmethylideneamino]-2,4-dichlorobenzamide | 2 - N-[(Z)-2-bicyclo[2.2.1]heptanylmethylideneamino]-2,4-dichlorobenzamide