| MolName | [3-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| MolecularFormula | C26H19N3O5 |
| Smiles | [O-][N+](c(cc1)ccc1C(Oc1cc(/C=N\NC(Cc2cccc3ccccc23)=O)ccc1)=O)=O |
| InChI | InChI=1S/C26H19N3O5/c30-25(16-21-8-4-7-19-6-1-2-10-24(19)21)28-27-17-18-5-3-9-23(15-18)34-26(31)20-11-13-22(14-12-20)29(32)33/h1-15,17H,16H2,(H,28,30) |
| InChIK | IICDYLGIUNZWBT-UHFFFAOYSA-N |
| TotalMolweight | 453.453 |
| Molweight | 453.453 |
| MonoisotopicMass | 453.132472 |
| CLogP | 4.903 |
| CLogS | -7.222 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 346.53 |
| Relative PSA | 0.25819 |
| PolarSurfaceArea | 113.58 |
| Druglikeness | -1.0276 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61765 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate | 2 - [3-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate