| MolName | 1-[(Z)-anthracen-9-ylmethylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| MolecularFormula | C26H24N4O3S2 |
| Smiles | O=S(c(cc1)ccc1NC(N/N=C\c1c(cccc2)c2cc2ccccc12)=S)(N1CCOCC1)=O |
| InChI | InChI=1S/C26H24N4O3S2/c31-35(32,30-13-15-33-16-14-30)22-11-9-21(10-12-22)28-26(34)29-27-18-25-23-7-3-1-5-19(23)17-20-6-2-4-8-24(20)25/h1-12,17-18H,13-16H2,(H2,28,29,34) |
| InChIK | IIEIJVNOXXBHCL-UHFFFAOYSA-N |
| TotalMolweight | 504.634 |
| Molweight | 504.634 |
| MonoisotopicMass | 504.128981 |
| CLogP | 5.0238 |
| CLogS | -6.739 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 373.03 |
| Relative PSA | 0.2803 |
| PolarSurfaceArea | 123.5 |
| Druglikeness | 2.2811 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 7 |
| Symmetricatoms | 11 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-anthracen-9-ylmethylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea | 2 - 1-[(Z)-anthracen-9-ylmethylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea