| MolName | 3-(3-bromophenoxy)-N-[(Z)-[9-[(Z)-[3-(3-bromophenoxy)propanoylhydrazinylidene]methyl]-1,10-phenanthrolin-2-yl]methylideneamino]propanamide |
| MolecularFormula | C32H26N6O4Br2 |
| Smiles | O=C(CCOc1cc(Br)ccc1)N/N=C\c1nc2c3nc(/C=N\NC(CCOc4cccc(Br)c4)=O)ccc3ccc2cc1 |
| InChI | InChI=1S/C32H26Br2N6O4/c33-23-3-1-5-27(17-23)43-15-13-29(41)39-35-19-25-11-9-21-7-8-22-10-12-26(38-32(22)31(21)37-25)20-36-40-30(42)14-16-44-28-6-2-4-24(34)18-28/h1-12,17-20H,13-16H2,(H,39,41)(H,40,42) |
| InChIK | IIGIHADSRLXOIZ-UHFFFAOYSA-N |
| TotalMolweight | 718.404 |
| Molweight | 718.404 |
| MonoisotopicMass | 716.038226 |
| CLogP | 6.9926 |
| CLogS | -9.054 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 479.74 |
| Relative PSA | 0.23755 |
| PolarSurfaceArea | 127.16 |
| Druglikeness | 1.9704 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 44 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 12 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 6 |
| Symmetricatoms | 22 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(3-bromophenoxy)-N-[(Z)-[9-[(Z)-[3-(3-bromophenoxy)propanoylhydrazinylidene]methyl]-1,10-phenanthrolin-2-yl]methylideneamino]propanamide | 2 - 3-(3-bromophenoxy)-N-[(Z)-[9-[(Z)-[3-(3-bromophenoxy)propanoylhydrazinylidene]methyl]-1,10-phenanthrolin-2-yl]methylideneamino]propanamide