| MolName | N-[(Z)-(3-bromophenyl)methylideneamino]-2-thiomorpholin-4-ium-4-ylacetamide |
| MolecularFormula | C13H17N3OBrS |
| Smiles | O=C(C[NH+]1CCSCC1)N/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C13H16BrN3OS/c14-12-3-1-2-11(8-12)9-15-16-13(18)10-17-4-6-19-7-5-17/h1-3,8-9H,4-7,10H2,(H,16,18)/p+1 |
| InChIK | IIGZIFCZSVJBSP-UHFFFAOYSA-O |
| TotalMolweight | 343.268 |
| Molweight | 343.268 |
| MonoisotopicMass | 342.027568 |
| CLogP | 0.0427 |
| CLogS | -3.261 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 242.99 |
| Relative PSA | 0.29256 |
| PolarSurfaceArea | 71.2 |
| Druglikeness | 2.4699 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-bromophenyl)methylideneamino]-2-thiomorpholin-4-ium-4-ylacetamide | 2 - N-[(Z)-(3-bromophenyl)methylideneamino]-2-thiomorpholin-4-ium-4-ylacetamide