| MolName | 2,6-bis(azepan-1-yl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]pyrimidin-4-amine |
| MolecularFormula | C23H30N6Cl2 |
| Smiles | Clc1cc(Cl)c(/C=N\Nc2nc(N3CCCCCC3)nc(N3CCCCCC3)c2)cc1 |
| InChI | InChI=1S/C23H30Cl2N6/c24-19-10-9-18(20(25)15-19)17-26-29-21-16-22(30-11-5-1-2-6-12-30)28-23(27-21)31-13-7-3-4-8-14-31/h9-10,15-17H,1-8,11-14H2,(H,27,28,29) |
| InChIK | IIUUINCCYLWEOE-UHFFFAOYSA-N |
| TotalMolweight | 461.439 |
| Molweight | 461.439 |
| MonoisotopicMass | 460.190898 |
| CLogP | 7.912 |
| CLogS | -7.462 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 356.32 |
| Relative PSA | 0.14596 |
| PolarSurfaceArea | 56.65 |
| Druglikeness | 0.29671 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 12 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2,6-bis(azepan-1-yl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]pyrimidin-4-amine | 2 - 2,6-bis(azepan-1-yl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]pyrimidin-4-amine