| MolName | N-[(Z)-(4-chlorophenyl)methylideneamino]-2-(1-hydroxycyclohexyl)acetamide |
| MolecularFormula | C15H19N2O2Cl |
| Smiles | OC1(CC(N/N=C\c(cc2)ccc2Cl)=O)CCCCC1 |
| InChI | InChI=1S/C15H19ClN2O2/c16-13-6-4-12(5-7-13)11-17-18-14(19)10-15(20)8-2-1-3-9-15/h4-7,11,20H,1-3,8-10H2,(H,18,19) |
| InChIK | IJRUXHCLYHQWLZ-UHFFFAOYSA-N |
| TotalMolweight | 294.781 |
| Molweight | 294.781 |
| MonoisotopicMass | 294.113505 |
| CLogP | 3.3389 |
| CLogS | -4.433 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 228.47 |
| Relative PSA | 0.21495 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 0.72264 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-(1-hydroxycyclohexyl)acetamide | 2 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-(1-hydroxycyclohexyl)acetamide