| MolName | 3-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-5-phenylthieno[2,3-d]pyrimidin-4-one |
| MolecularFormula | C21H14N3OBrS |
| Smiles | O=C(c1c(N=C2)scc1-c1ccccc1)N2/N=C\C(\Br)=C\c1ccccc1 |
| InChI | InChI=1S/C21H14BrN3OS/c22-17(11-15-7-3-1-4-8-15)12-24-25-14-23-20-19(21(25)26)18(13-27-20)16-9-5-2-6-10-16/h1-14H |
| InChIK | IKSKHQSYTSVFNT-UHFFFAOYSA-N |
| TotalMolweight | 436.332 |
| Molweight | 436.332 |
| MonoisotopicMass | 435.004093 |
| CLogP | 4.7161 |
| CLogS | -7.06 |
| H Acceptors | 4 |
| TotalSurfaceArea | 296.13 |
| Relative PSA | 0.20251 |
| PolarSurfaceArea | 73.27 |
| Druglikeness | 0.49585 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-5-phenylthieno[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-5-phenylthieno[2,3-d]pyrimidin-4-one