| MolName | [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4-nitrophenyl] benzoate |
| MolecularFormula | C31H22N4O8 |
| Smiles | [O-][N+](c(cc1)cc(/C=N\NC(/C(/NC(c2ccccc2)=O)=C/c(cc2)cc3c2OCO3)=O)c1OC(c1ccccc1)=O)=O |
| InChI | InChI=1S/C31H22N4O8/c36-29(21-7-3-1-4-8-21)33-25(15-20-11-13-27-28(16-20)42-19-41-27)30(37)34-32-18-23-17-24(35(39)40)12-14-26(23)43-31(38)22-9-5-2-6-10-22/h1-18H,19H2,(H,33,36)(H,34,37) |
| InChIK | IKVGIIKXRIIRSG-UHFFFAOYSA-N |
| TotalMolweight | 578.536 |
| Molweight | 578.536 |
| MonoisotopicMass | 578.143766 |
| CLogP | 5.4386 |
| CLogS | -8.107 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 432.11 |
| Relative PSA | 0.31004 |
| PolarSurfaceArea | 161.14 |
| Druglikeness | 1.087 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.44186 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4-nitrophenyl] benzoate | 2 - [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4-nitrophenyl] benzoate