| MolName | [4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] benzoate |
| MolecularFormula | C15H13N3O3 |
| Smiles | NC(N/N=C\c(cc1)ccc1OC(c1ccccc1)=O)=O |
| InChI | InChI=1S/C15H13N3O3/c16-15(20)18-17-10-11-6-8-13(9-7-11)21-14(19)12-4-2-1-3-5-12/h1-10H,(H3,16,18,20) |
| InChIK | ILESYWOOTMMWEU-UHFFFAOYSA-N |
| TotalMolweight | 283.286 |
| Molweight | 283.286 |
| MonoisotopicMass | 283.095692 |
| CLogP | 2.5658 |
| CLogS | -4.284 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 223.26 |
| Relative PSA | 0.33289 |
| PolarSurfaceArea | 93.78 |
| Druglikeness | 3.9438 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] benzoate | 2 - [4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] benzoate