| MolName | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine |
| MolecularFormula | C18H12N3O3BrS |
| Smiles | O=S(c1c2cccc1)(N=C2N/N=C\c1ccc(-c(cc2)ccc2Br)o1)=O |
| InChI | InChI=1S/C18H12BrN3O3S/c19-13-7-5-12(6-8-13)16-10-9-14(25-16)11-20-21-18-15-3-1-2-4-17(15)26(23,24)22-18/h1-11H,(H,21,22) |
| InChIK | ILHPCUVPPYYNQB-UHFFFAOYSA-N |
| TotalMolweight | 430.281 |
| Molweight | 430.281 |
| MonoisotopicMass | 428.978273 |
| CLogP | 4.5036 |
| CLogS | -6.021 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 275.37 |
| Relative PSA | 0.28024 |
| PolarSurfaceArea | 92.41 |
| Druglikeness | 3.506 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine | 2 - N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine