| MolName | N-[(Z)-[4-[[6-[(2-fluorobenzoyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]-3-nitrophenyl]methylideneamino]pyridine-4-carboxamide |
| MolecularFormula | C27H17N6O4FS2 |
| Smiles | [O-][N+](c(cc(/C=N\NC(c1ccncc1)=O)cc1)c1Sc1nc(ccc(NC(c(cccc2)c2F)=O)c2)c2s1)=O |
| InChI | InChI=1S/C27H17FN6O4S2/c28-20-4-2-1-3-19(20)26(36)31-18-6-7-21-24(14-18)40-27(32-21)39-23-8-5-16(13-22(23)34(37)38)15-30-33-25(35)17-9-11-29-12-10-17/h1-15H,(H,31,36)(H,33,35) |
| InChIK | ILJBSOOHXKRLDW-UHFFFAOYSA-N |
| TotalMolweight | 572.6 |
| Molweight | 572.6 |
| MonoisotopicMass | 572.073672 |
| CLogP | 4.8504 |
| CLogS | -7.834 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 411.29 |
| Relative PSA | 0.36646 |
| PolarSurfaceArea | 195.7 |
| Druglikeness | -1.3862 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[[6-[(2-fluorobenzoyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]-3-nitrophenyl]methylideneamino]pyridine-4-carboxamide | 2 - N-[(Z)-[4-[[6-[(2-fluorobenzoyl)amino]-1,3-benzothiazol-2-yl]sulfanyl]-3-nitrophenyl]methylideneamino]pyridine-4-carboxamide