| MolName | [2,4-dibromo-6-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
| MolecularFormula | C26H17N2O3Br2F |
| Smiles | O=C(Cc1cccc2ccccc12)N/N=C\c1cc(Br)cc(Br)c1OC(c1cc(F)ccc1)=O |
| InChI | InChI=1S/C26H17Br2FN2O3/c27-20-11-19(25(23(28)14-20)34-26(33)18-8-4-9-21(29)12-18)15-30-31-24(32)13-17-7-3-6-16-5-1-2-10-22(16)17/h1-12,14-15H,13H2,(H,31,32) |
| InChIK | ILZIMDCRVPFZNN-UHFFFAOYSA-N |
| TotalMolweight | 584.238 |
| Molweight | 584.238 |
| MonoisotopicMass | 581.958993 |
| CLogP | 7.3758 |
| CLogS | -8.744 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 366.47 |
| Relative PSA | 0.16113 |
| PolarSurfaceArea | 67.76 |
| Druglikeness | 0.89902 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] 3-fluorobenzoate | 2 - [2,4-dibromo-6-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] 3-fluorobenzoate