| MolName | [2-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-4-nitrophenyl] benzoate |
| MolecularFormula | C20H13N4O5Br |
| Smiles | [O-][N+](c(cc1)cc(/C=N\NC(c2cc(Br)cnc2)=O)c1OC(c1ccccc1)=O)=O |
| InChI | InChI=1S/C20H13BrN4O5/c21-16-8-15(10-22-12-16)19(26)24-23-11-14-9-17(25(28)29)6-7-18(14)30-20(27)13-4-2-1-3-5-13/h1-12H,(H,24,26) |
| InChIK | IMIPLSNBEOIPEY-UHFFFAOYSA-N |
| TotalMolweight | 469.25 |
| Molweight | 469.25 |
| MonoisotopicMass | 468.006932 |
| CLogP | 3.4348 |
| CLogS | -5.69 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 315.56 |
| Relative PSA | 0.31829 |
| PolarSurfaceArea | 126.47 |
| Druglikeness | -2.8781 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-4-nitrophenyl] benzoate | 2 - [2-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]-4-nitrophenyl] benzoate