| MolName | (2Z)-3-(4-hydroxyphenyl)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| MolecularFormula | C16H12N4O4S |
| Smiles | [O-][N+](c1ccc(/C=N\N=C(\N2c(cc3)ccc3O)/SCC2=O)cc1)=O |
| InChI | InChI=1S/C16H12N4O4S/c21-14-7-5-12(6-8-14)19-15(22)10-25-16(19)18-17-9-11-1-3-13(4-2-11)20(23)24/h1-9,21H,10H2 |
| InChIK | IMXJKADFWCZBCB-UHFFFAOYSA-N |
| TotalMolweight | 356.361 |
| Molweight | 356.361 |
| MonoisotopicMass | 356.057926 |
| CLogP | 3.0495 |
| CLogS | -5.158 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 256.57 |
| Relative PSA | 0.39217 |
| PolarSurfaceArea | 136.38 |
| Druglikeness | -1.1327 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-3-(4-hydroxyphenyl)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one | 2 - (2Z)-3-(4-hydroxyphenyl)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one