| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C24H24N9O4Cl |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2OCc(cc2)ccc2Cl)=O)c1CN1CCOCC1 |
| InChI | InChI=1S/C24H24ClN9O4/c25-18-5-1-17(2-6-18)15-37-19-7-3-16(4-8-19)13-27-29-24(35)21-20(14-33-9-11-36-12-10-33)34(32-28-21)23-22(26)30-38-31-23/h1-8,13H,9-12,14-15H2,(H2,26,30)(H,29,35) |
| InChIK | IMZBKORZLGXKCO-UHFFFAOYSA-N |
| TotalMolweight | 537.967 |
| Molweight | 537.967 |
| MonoisotopicMass | 537.163978 |
| CLogP | 3.2954 |
| CLogS | -3.11 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 403.74 |
| Relative PSA | 0.34599 |
| PolarSurfaceArea | 158.81 |
| Druglikeness | 2.4475 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 9 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide