| MolName | 1-[(Z)-furan-2-ylmethylideneamino]tetrazol-5-amine |
| MolecularFormula | C6H6N6O |
| Smiles | Nc1nnnn1/N=C\c1ccco1 |
| InChI | InChI=1S/C6H6N6O/c7-6-9-10-11-12(6)8-4-5-2-1-3-13-5/h1-4H,(H2,7,9,11) |
| InChIK | INBQWCMYIORWDV-UHFFFAOYSA-N |
| TotalMolweight | 178.155 |
| Molweight | 178.155 |
| MonoisotopicMass | 178.060309 |
| CLogP | 0.4152 |
| CLogS | -3.469 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 141.47 |
| Relative PSA | 0.57023 |
| PolarSurfaceArea | 95.12 |
| Druglikeness | 0.97213 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-furan-2-ylmethylideneamino]tetrazol-5-amine | 2 - 1-[(Z)-furan-2-ylmethylideneamino]tetrazol-5-amine