| MolName | 5-chloro-2-hydroxy-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]benzamide |
| MolecularFormula | C16H13N2O2Cl |
| Smiles | Oc(ccc(Cl)c1)c1C(N/N=C\C=C\c1ccccc1)=O |
| InChI | InChI=1S/C16H13ClN2O2/c17-13-8-9-15(20)14(11-13)16(21)19-18-10-4-7-12-5-2-1-3-6-12/h1-11,20H,(H,19,21) |
| InChIK | INMJRMBKJZXMFI-UHFFFAOYSA-N |
| TotalMolweight | 300.744 |
| Molweight | 300.744 |
| MonoisotopicMass | 300.066555 |
| CLogP | 3.4802 |
| CLogS | -4.453 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 235.26 |
| Relative PSA | 0.20875 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 4.4417 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-chloro-2-hydroxy-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]benzamide | 2 - 5-chloro-2-hydroxy-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]benzamide