| MolName | 3-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C18H14N3OF3S |
| Smiles | O=C(c1c(N=C2)sc3c1CCCC3)N2/N=C\c1c(C(F)(F)F)cccc1 |
| InChI | InChI=1S/C18H14F3N3OS/c19-18(20,21)13-7-3-1-5-11(13)9-23-24-10-22-16-15(17(24)25)12-6-2-4-8-14(12)26-16/h1,3,5,7,9-10H,2,4,6,8H2 |
| InChIK | IOFOCLNAWBGKMU-UHFFFAOYSA-N |
| TotalMolweight | 377.389 |
| Molweight | 377.389 |
| MonoisotopicMass | 377.080966 |
| CLogP | 4.5333 |
| CLogS | -5.829 |
| H Acceptors | 4 |
| TotalSurfaceArea | 264.03 |
| Relative PSA | 0.22713 |
| PolarSurfaceArea | 73.27 |
| Druglikeness | -5.8617 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one