| MolName | 2-N,5-N-bis[(Z)-cyclohex-3-en-1-ylmethylideneamino]furan-2,5-dicarboxamide |
| MolecularFormula | C20H24N4O3 |
| Smiles | O=C(c1ccc(C(N/N=C\C2CC=CCC2)=O)o1)N/N=C\C1CC=CCC1 |
| InChI | InChI=1S/C20H24N4O3/c25-19(23-21-13-15-7-3-1-4-8-15)17-11-12-18(27-17)20(26)24-22-14-16-9-5-2-6-10-16/h1-3,5,11-16H,4,6-10H2,(H,23,25)(H,24,26) |
| InChIK | IOVQKGPQDKIODC-UHFFFAOYSA-N |
| TotalMolweight | 368.436 |
| Molweight | 368.436 |
| MonoisotopicMass | 368.184841 |
| CLogP | 2.6143 |
| CLogS | -5.232 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 304.45 |
| Relative PSA | 0.2829 |
| PolarSurfaceArea | 96.06 |
| Druglikeness | 0.59693 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 2 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 8 |
| Symmetricatoms | 13 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - 2-N,5-N-bis[(Z)-cyclohex-3-en-1-ylmethylideneamino]furan-2,5-dicarboxamide | 2 - 2-N,5-N-bis[(Z)-cyclohex-3-en-1-ylmethylideneamino]furan-2,5-dicarboxamide