| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C20H15N10O2ClS |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2Cl)=O)c1CSc1nc(cccc2)c2[nH]1 |
| InChI | InChI=1S/C20H15ClN10O2S/c21-12-7-5-11(6-8-12)9-23-27-19(32)16-15(31(30-26-16)18-17(22)28-33-29-18)10-34-20-24-13-3-1-2-4-14(13)25-20/h1-9H,10H2,(H2,22,28)(H,24,25)(H,27,32) |
| InChIK | IOXLFSNEZKKMRQ-UHFFFAOYSA-N |
| TotalMolweight | 494.926 |
| Molweight | 494.926 |
| MonoisotopicMass | 494.078867 |
| CLogP | 4.1585 |
| CLogS | -4.597 |
| H Acceptors | 12 |
| H Donors | 3 |
| TotalSurfaceArea | 358.56 |
| Relative PSA | 0.4423 |
| PolarSurfaceArea | 191.09 |
| Druglikeness | 2.4199 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 7 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]triazole-4-carboxamide